| Identification | |
| Name: | Hexanoic acid,2-bromo-, methyl ester |
| Synonyms: | 2-Bromohexanoic acid methyl ester;Methyl 2-bromocaproate;Methyl a-bromocaproate;NSC 21976; |
| CAS: | 5445-19-2 |
| EINECS: | 226-643-9 |
| Molecular Formula: | C7H13BrO2 |
| Molecular Weight: | 209.08092 |
| InChI: | InChI=1S/C7H13BrO2/c1-3-4-5-6(8)7(9)10-2/h6H,3-5H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.289 |
| Refractive index: | n20/D 1.455 |
| Appearance: | Clear, colourless liquid |
| Specification: | Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
