Identification |
Name: | 1-n-Butylcyclohexanol |
Synonyms: | Cyclohexanol, 1-butyl-;1-BUTYLCYCLOHEXANOL;1-N-BUTYLCYCLOHEXANOL;1-n-Butylcyclohexanol,98%;1-Butyl-1-cyclohexanol |
CAS: | 5445-30-7 |
Molecular Formula: | C10H20O |
Molecular Weight: | 156.2652 |
InChI: | InChI=1S/C10H20O/c1-2-3-7-10(11)8-5-4-6-9-10/h11H,2-9H2,1H3 |
Molecular Structure: |
|
Properties |
Flash Point: | 84.6°C |
Boiling Point: | 210.9°Cat760mmHg |
Density: | 0.906g/cm3 |
Refractive index: | 1.465 |
Specification: | usageEng:Intermediates of Liquid Crystals Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face
protection |
Flash Point: | 84.6°C |
Usage: | Intermediates of Liquid Crystals |
Safety Data |
|
|