| Identification | |
| Name: | 1-n-Butylcyclohexanol |
| Synonyms: | Cyclohexanol, 1-butyl-;1-BUTYLCYCLOHEXANOL;1-N-BUTYLCYCLOHEXANOL;1-n-Butylcyclohexanol,98%;1-Butyl-1-cyclohexanol |
| CAS: | 5445-30-7 |
| Molecular Formula: | C10H20O |
| Molecular Weight: | 156.2652 |
| InChI: | InChI=1S/C10H20O/c1-2-3-7-10(11)8-5-4-6-9-10/h11H,2-9H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 84.6°C |
| Boiling Point: | 210.9°Cat760mmHg |
| Density: | 0.906g/cm3 |
| Refractive index: | 1.465 |
| Specification: | usageEng:Intermediates of Liquid Crystals Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Flash Point: | 84.6°C |
| Usage: | Intermediates of Liquid Crystals |
| Safety Data | |
 |
|
