| Identification | |
| Name: | Pyridine,2-bromo-4-ethyl- |
| Synonyms: | 2-Bromo-4-ethylpyridine;4-Ethyl-2-bromopyridine |
| CAS: | 54453-91-7 |
| Molecular Formula: | C7H8 Br N |
| Molecular Weight: | 186.05 |
| InChI: | InChI=1/C7H8BrN/c1-2-6-3-4-9-7(8)5-6/h3-5H,2H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 98.6°C |
| Boiling Point: | 239.5°C at 760 mmHg |
| Density: | 1.413g/cm3 |
| Refractive index: | 1.544 |
| Specification: |
2-Bromo-4-ethylpyridine with cas registry number of 54453-91-7 is also known as 2-Bromo-4-ethylpyridine ; Pyridine, 2-bromo-4-ethyl- . It is an aromatics compound with the appearance of yellow liquid which should be stored in a cool, dry place in tightly closed containers. 2-Bromo-4-ethylpyridine with cas registry number of 54453-91-7 is used as a pharmaceutical intermediate . |
| Flash Point: | 98.6°C |
| Safety Data | |
 |
|
