| Identification | |
| Name: | 2,3,4,5-Tetramethyl-2-cyclopentenone |
| Synonyms: | 2,3,4,5-Tetramethyl-2-cyclopenten-1-one;Tetramethylcyclopent-2-enone; |
| CAS: | 54458-61-6 |
| EINECS: | -0 |
| Molecular Formula: | C9H14O |
| Molecular Weight: | 138.21 |
| InChI: | InChI=1/C9H14O/c1-5-6(2)8(4)9(10)7(5)3/h5,7H,1-4H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 0.917 |
| Refractive index: | 1.476 |
| Appearance: | Yellowish or colorless clearly liquid |
| Specification: |
2,3,4,5-Tetramethyl-2-cyclopentenone ,with CAS number of 54458-61-6,can be called 2,3,4,5-Tetramethyl-2-cyclopenten-1-one ; 2,3,4,5-Tetramethyl-2-cyclopentenone ; 2,3,4,5-Tetramethylcyclopent-2-enone ; 2,3,4,5-tetramethyl-2-cyclopentanone (cis+trans) ; 2,3,4,5-Tetramethyl-2-cyclopentenone (mixture of cis- and trans- isomers) ; 2,3,4,5-Tetramethyl-2-cyclopentenone, 95 %, mixture of cis and trans ; 2,3,4,5-tetramethyl-2-cyclopentenone, cis + trans ; 2,3,4,5-tetramethyl-2-cyclopentenone, mixture of cis and trans . |
| Safety Data | |
 |
|
