| Identification | |
| Name: | Hexane,1-(1-ethoxyethoxy)- |
| Synonyms: | Acetaldehyde,ethyl hexyl acetal (6CI); 1-Ethoxy-1-hexyloxyethane |
| CAS: | 54484-73-0 |
| EINECS: | 259-184-8 |
| Molecular Formula: | C10H22 O2 |
| Molecular Weight: | 174.32 |
| InChI: | InChI=1/C10H22O2/c1-4-6-7-8-9-12-10(3)11-5-2/h10H,4-9H2,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 48.8°C |
| Boiling Point: | 196.2°C at 760 mmHg |
| Density: | 0.843g/cm3 |
| Refractive index: | 1.415 |
| Specification: |
Ethyl hexyl acetal with cas registry number of 54484-73-0 is also known as 1-(1-Ethoxyethoxy)hexane ; Hexane,1-(1-ethoxyethoxy)- ; Acetaldehyde ethyl hexyl acetal ; 1-Ethoxy-1-hexyl oxyethane ; 1-(1-Ethoxyethoxy)hexan ; lilivert,BBA . It is a colorless clear liquid with aroma that like natural green floral earthy fungal. It can be soluble in alcohol and slightly in water. Ethyl hexyl acetal is widely applied in the use of fruity, food and flavors. It can be produced by the reaction of Vinyl ether and Hexanol and acid catalyst is added at the same time. Besides, It can be directly produced by the reaction of Acetal and Hexanol . |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 48.8°C |
| Safety Data | |
 |
|
