| Identification | |
| Name: | Acetic acid, 2-iodo-,1,1'-(1,2-ethanediyl) ester |
| Synonyms: | Aceticacid, iodo-, 1,2-ethanediyl ester (9CI); Acetic acid, iodo-, ethylene ester(7CI,8CI); Ethylene glycol bis(iodoacetate); NSC 21820; NSC 59487 |
| CAS: | 5451-51-4 |
| Molecular Formula: | C6H8 I2 O4 |
| Molecular Weight: | 397.94 |
| InChI: | InChI=1/C6H8I2O4/c7-3-5(9)11-1-2-12-6(10)4-8/h1-4H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 180.2°C |
| Boiling Point: | 374.3°C at 760 mmHg |
| Density: | 2.31g/cm3 |
| Refractive index: | 1.605 |
| Specification: |
Ethylene bis(iodoacetate) , its cas register number is 5451-51-4. It also can be called AI3-30442 ; Acetic acid, iodo-, diester with ethylene glycol ; Acetic acid, iodo-, ethylene ester ; Ethylene bis(iodoacetate) ; NSC 21820 ; NSC 59487 ; S 10 . |
| Flash Point: | 180.2°C |
| Safety Data | |
 |
|
