| Identification | |
| Name: | n-Butyl cyanoacetate |
| Synonyms: | Cyano acetic acid butyl ester; Acetic acid, cyano-, butyl ester; Aceticacid,cyano-,butylester; cyano-aceticacibutylester; BUTYL CYANOACETATE; BUTYL CYANOACETATE(N-); CYANOACETIC ACID N-BUTYL ESTER ; CYANOACETIC N-BUTYL ESTER ; BCYA ; n-Butyl cyanoacetate, 99+%; AButyl cyanoacetate |
| CAS: | 5459-58-5 |
| EINECS: | 226-730-1 |
| Molecular Formula: | C7H11NO2 |
| Molecular Weight: | 141.17 |
| InChI: | InChI=1/C7H11NO2/c1-2-3-6-10-7(9)4-5-8/h2-4,6H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3276 |
| Melting Point: | -80 |
| Density: | 1.001 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.425-1.427 |
| Water Solubility: | IMMISCIBLE |
| Solubility: | IMMISCIBLE |
| Appearance: | Clear Liquid |
| Specification: |
Butyl cyanoacetate , its CAS NO. is 5459-58-5, the synonyms are 4-02-00-01891 (Beilstein Handbook Reference) ; BRN 1761735 ; EINECS 226-730-1 ; n-Butyl cyanoacetate ; Acetic acid, 2-cyano-, butyl ester ; Acetic acid, cyano-, butyl ester . |
| Packinggroup: | III |
| Storage Temperature: | Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Usage: | Butyl cyanoacetate is used as intermediate for numerous organic syntheses, e.g. alpha-cyanoacrylic adhesives. Product Data Sheet |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
