| Identification | |
| Name: | Bicyclo[3.1.0]hexan-3-one,4-methyl-1-(1-methylethyl)-, (1S,4R,5R)- |
| Synonyms: | 3-Thujanone,(1S,4R,5R)-(-)- (8CI); Bicyclo[3.1.0]hexan-3-one, 4-methyl-1-(1-methylethyl)-,[1S-(1a,4a,5a)]-; (-)-Thujone; (-)-a-Thujone; NSC 93742; Thujon; Thujone; a-Thujone |
| CAS: | 546-80-5 |
| EINECS: | 208-912-2 |
| Molecular Formula: | C10H16 O |
| Molecular Weight: | 152.23344 |
| InChI: | InChI=1S/C10H16O/c1-6(2)10-4-8(10)7(3)9(11)5-10/h6-8H,4-5H2,1-3H3/t7-,8-,10+/m1/s1 |
| Molecular Structure: | ![(C10H16O) 3-Thujanone,(1S,4R,5R)-(-)- (8CI); Bicyclo[3.1.0]hexan-3-one, 4-methyl-1-(1-methylethyl)-,[1S-(1a,4a...](https://img1.guidechem.com/chem/e/dict/32/546-80-5.jpg) |
| Properties | |
| Transport: | UN 2810 6.1/PG 3 |
| Refractive index: | n20/D 1.450 |
| Water Solubility: | Insoluble in water; soluble in ethanol, diethyl ether and chloroform (Albert-Puleo, 1978; Lewis, 1993) |
| Solubility: | Insoluble in water; soluble in ethanol, diethyl ether and chloroform (Albert-Puleo, 1978; Lewis, 1993) |
| Appearance: | Colorless or almost colorless liquid with a menthol- like odor (Albert-Puleo, 1978; Budavari, 1996) |
| Specification: | Safety Statements:23-26-36/37/39-45 23:Do not breathe gas/fumes/vapor/spray (appropriate wording to be specified by the manufacturer) 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) |
| Report: |
Reported in EPA TSCA Inventory. |
| Storage Temperature: | 2-8°C |
| Safety Data | |
| Hazard Symbols | |
 |
|
