| Identification |
| Name: | Lithium Acetate |
| Synonyms: | Acetic acid lithium salt; lithium acetate; Lithium Acetate Anhydrous |
| CAS: | 546-89-4 |
| EINECS: | 208-914-3 |
| Molecular Formula: | C2H3LiO2 |
| Molecular Weight: | 65.98 |
| InChI: | InChI=1/C2H4O2.Li/c1-2(3)4;/h1H3,(H,3,4);/q;+1/p-1 |
| Molecular Structure: |
 |
| Properties |
| Density: | g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Appearance: | solid |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Usage: | Buffer for gel electrophoresis of dna and rna. |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
