| Identification |
| Name: | Carbonic acid,magnesium salt (1:1) |
| Synonyms: | DCI light magnesium carbonate;Destab;Magnesium(II) carbonate (1:1); |
| CAS: | 546-93-0 |
| EINECS: | 208-915-9 |
| Molecular Formula: | CMgO3 |
| Molecular Weight: | 84.31 |
| InChI: | InChI=1S/CH2O3.Mg/c2-1(3)4;/h(H2,2,3,4);/q;+2/p-2 |
| Molecular Structure: |
 |
| Properties |
| Melting Point: | 990 deg C |
| Density: | g/cm3 |
| Water Solubility: | Stability Stable. Incompatible with strong oxidizing agents, acids. Toxicology Not hazardous according to Directive 67/548/EEC. Toxicity data (The meaning of any |
| Solubility: | |
| Appearance: | white crystalline solid or crystalline powder |
| Color: | Light, bulky, white powder |
| Safety Data |
| |
 |
