| Identification | |
| Name: | 2-Thiophenecarboximidamide,hydrochloride (1:1) |
| Synonyms: | 2-Thiophenecarboxamidine,hydrochloride (6CI);2-Thiophenecarboximidamide,monohydrochloride (9CI);2-Amidinothiophene hydrochloride;2-Thienylamidine monohydrochloride;Thiophene-2-carboximidamide hydrochloride |
| CAS: | 54610-70-7 |
| Molecular Formula: | C5H6 N2 S . Cl H |
| Molecular Weight: | 162.64 |
| InChI: | InChI=1/C5H6N2S.ClH/c6-5(7)4-2-1-3-8-4;/h1-3H,(H3,6,7);1H |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 172-175°C |
| Flash Point: | 87.3°C |
| Boiling Point: | 220.8°C at 760 mmHg |
| Specification: | Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Flash Point: | 87.3°C |
| Safety Data | |
 |
|
