| Identification |
| Name: | 2-Benzothiazolamine,4-methoxy- |
| Synonyms: | Benzothiazole,1-amino-3-methoxy- (3CI);Benzothiazole, 2-amino-4-methoxy- (6CI,8CI);(4-Methoxybenzothiazol-2-yl)amine;2-Amino-4-methoxy-1,3-benzothiazole;2-Amino-4-methoxybenzothiazole;4-Methoxy-1,3-benzothiazol-2-amine;4-Methoxy-1,3-benzothiazol-2-ylamine;4-Methoxy-2-benzothiazolamine;NSC 28740; |
| CAS: | 5464-79-9 |
| EINECS: | 226-763-1 |
| Molecular Formula: | C8H8N2OS |
| Molecular Weight: | 180.22 |
| InChI: | InChI=1/C8H8N2OS/c1-11-5-3-2-4-6-7(5)10-8(9)12-6/h2-4H,1H3,(H2,9,10) |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.359 g/cm3 |
| Stability: | No data. |
| Water Solubility: | | <0.1 g/100 mL at 19.5 ºC |
| Solubility: | <0.1 g/100 mL at 19.5 ºC in water |
| Appearance: | Off-white to white crystal powder |
| Storage Temperature: | Keep in a cool, dry, dark location in a tightly sealed container or cylinder. Keep away from incompatible materials, ignition sources and untrained individuals. Secure and label area. Protect containers/cylinders from physical damage. |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
