| Identification | |
| Name: | 2H-1,4-benzoxazin-3(4H)-one |
| Synonyms: | - |
| CAS: | 5466-88-6 |
| Molecular Formula: | C8H7NO2 |
| Molecular Weight: | 149.14668 |
| InChI: | InChI=1S/C8H7NO2/c10-8-5-11-7-4-2-1-3-6(7)9-8/h1-4H,5H2,(H,9,10) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.244 g/cm3 |
| Refractive index: | 1.563 |
| Water Solubility: | Insoluble in water,soluble in ethanol, acetone, chloroform,ethylacetate |
| Solubility: | Insoluble in water,soluble in ethanol, acetone, chloroform,ethylacetate |
| Appearance: | white to almost white crystalline powder |
| Specification: |
2H-1,4-Benzoxazin-3(4H)-one , with CAS number of 5466-88-6, can be called Benzo[b]morpholin-3-one ; aurora ka-5421;4h-benzo[1,4]oxazin-3-one ; 4-aza-3-chromanone ; 2h-1,4-benzoxazin-3(4h)-one ; 2h-1,4-benzoxazine-3(4h)-one ; 2h-benzo[b][1,4]oxazin-3(4h)-one ; otava-bb bb7020041238 .It is a white to almost white crystalline powder. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
