| Identification | |
| Name: | 2-Chloro-3-nitropyridine |
| Synonyms: | 4-CHLORO-3-SULFONAMIDOPYRIDINE |
| CAS: | 5470-18-8 |
| EINECS: | 226-799-8 |
| Molecular Formula: | C5H3ClN2O2 |
| Molecular Weight: | 158.54252 |
| InChI: | InChI=1S/C5H3ClN2O2/c6-5-4(8(9)10)2-1-3-7-5/h1-3H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2811 |
| Density: | 1.489 g/cm 3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.454-1.456 |
| Water Solubility: | insoluble in water |
| Solubility: | insoluble in water |
| Appearance: | yellow crystal |
| Specification: | yellow crystalline powder Safety Statements:22-24/25-37/39-26-36 22:Do not breathe dust 24/25:Avoid contact with skin and eyes 37/39:Wear suitable protective clothing, gloves and eye/face protection 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| HS Code: | 29333999 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
