| Identification | |
| Name: | 6H-Pyrido[4,3-b]carbazol-9-amine,5,11-dimethyl- |
| Synonyms: | 9-Aminoellipticine;NSC 191345 |
| CAS: | 54779-53-2 |
| Molecular Formula: | C17H15 N3 |
| Molecular Weight: | 261.35 |
| InChI: | InChI=1/C17H15N3/c1-9-14-8-19-6-5-12(14)10(2)17-16(9)13-7-11(18)3-4-15(13)20-17/h3-8,20H,18H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 330.5°C |
| Boiling Point: | 565.6°C at 760 mmHg |
| Density: | 1.318g/cm3 |
| Refractive index: | 1.819 |
| Specification: |
9-Aminoellipticine (CAS NO.54779-53-2) is also called 5,11-Dimethyl-6H-pyrido[4,3-b]carbazol-9-amine ; ICIG-1089 . 9-Aminoellipticine (CAS NO.54779-53-2) is a kind of toxic substances. It is flammable. It will produce toxic nitrogen oxide fumes when buring. So the storage environment of 9-Aminoellipticine (CAS NO.54779-53-2) should be ventilate, low-temperature and dry. |
| Flash Point: | 330.5°C |
| Safety Data | |
 |
|
