| Identification | |
| Name: | Butanedioic acid,2,3-dihydroxy- (2R,3R)-, 1,4-dihydrazide |
| Synonyms: | Butanedioicacid, 2,3-dihydroxy- (2R,3R)-, dihydrazide (9CI);Butanedioic acid,2,3-dihydroxy- [R-(R*,R*)]-, dihydrazide;Tartaric acid, dihydrazide (6CI);L-Tartaric dihydrazide;NSC 243481;Tartaric acid 1,4-dihydrazide;Tartarohydrazide; |
| CAS: | 54789-92-3 |
| EINECS: | 259-349-4 |
| Molecular Formula: | C4H10N4O4 |
| Molecular Weight: | 178.15 |
| InChI: | InChI=1/C4H10N4O4/c5-7-3(11)1(9)2(10)4(12)8-6/h1-2,9-10H,5-6H2,(H,7,11)(H,8,12)/t1-,2-/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.626 g/cm3 |
| Refractive index: | 1.608 |
| Specification: |
The Tartaric acid dihydrazide with the CAS number 54789-92-3 is also called Butanedioic acid,2,3-dihydroxy- (2R,3R)-, 1,4-dihydrazide. Both the systematic name and IUPAC name are (2R,3R)-2,3-dihydroxybutanedihydrazide. Its EINECS registry number is 259-349-4. The molecular formula is C4H10N4O4. The properties of the chemical are: (1)ACD/LogP: -2.94; (2)# of Rule of 5 Violations: 1; (3)ACD/LogD (pH 5.5): -2.95; (4)ACD/LogD (pH 7.4): -2.94; (5)ACD/BCF (pH 5.5): 1; (6)ACD/BCF (pH 7.4): 1; (7)ACD/KOC (pH 5.5): 1; (8)ACD/KOC (pH 7.4): 1; (9)#H bond acceptors: 8; (10)#H bond donors: 8; (11)#Freely Rotating Bonds: 7; (12)Polar Surface Area: 65.56 Å2; (13)Index of Refraction: 1.608; (14)Molar Refractivity: 37.88 cm3; (15)Molar Volume: 109.5 cm3; (16)Polarizability: 15.01×10-24cm3; (17)Surface Tension: 96.8 dyne/cm; (18)Enthalpy of Vaporization: 120.89 kJ/mol; (19)Vapour Pressure: 2.92×10-24 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
