| Identification | |
| Name: | Quinoline,8-[(tributylstannyl)oxy]- |
| Synonyms: | NSC 164912;Tin(IV), (8-quinolinolato)tributyl- |
| CAS: | 5488-45-9 |
| EINECS: | 226-820-0 |
| Molecular Formula: | C21H33 N O Sn |
| Molecular Weight: | 434.24 |
| InChI: | InChI=1/C9H7NO.3C4H9.Sn/c11-8-5-1-3-7-4-2-6-10-9(7)8;3*1-3-4-2;/h1-6,11H;3*1,3-4H2,2H3;/q;;;;+1/p-1/rC21H33NOSn/c1-4-7-16-24(17-8-5-2,18-9-6-3)23-20-14-10-12-19-13-11-15-22-21(19)20/h10-15H,4-9,16-18H2,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | °C |
| Boiling Point: | °Cat760mmHg |
| Density: | g/cm3 |
| Specification: |
Tributyl(8-quinolinolato)tin , its cas register number is 5488-45-9. It also can be called Stannane, (8-quinolinolato)tributyl- ; Quinoline, 8-((tributylstannyl)oxy)- (8CI) ; and 8-((Tributylstannyl)oxy)quinoline . |
| Flash Point: | °C |
| Safety Data | |
| Hazard Symbols | |
 |
|
