| Identification | |
| Name: | Chlorproheptatrien |
| Synonyms: | Chlorproheptatrien;5H-Dibenzo(a,d)cycloheptene-delta(sup 5)-gamma-propylamine, 3-chloro-N,N-dimethyl-, monohydrochloride;LS-60731;5490-31-3 |
| CAS: | 5490-31-3 |
| Molecular Formula: | C20H20ClN . ClH |
| Molecular Weight: | 346.2934 |
| InChI: | InChI=1/C20H20ClN.ClH/c1-22(2)13-5-8-19-18-7-4-3-6-15(18)9-10-16-11-12-17(21)14-20(16)19;/h3-4,6-12,14H,5,13H2,1-2H3;1H/b19-8-; |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 214.4°C |
| Boiling Point: | 430.9°C at 760 mmHg |
| Specification: |
Chlorproheptatrien , its cas register number is 5490-31-3. It also can be called 5H-Dibenzo(a,d)cycloheptene-delta(sup 5)-gamma-propylamine,3-chloro-N,N-dimethyl-,monohydrochloride .When heated to decomposition it emits very toxic fumes of Cl− and NOx.Vapor of Chlorproheptatrien (CAS NO.5490-31-3) is toxic. |
| Flash Point: | 214.4°C |
| Safety Data | |
 |
|
