Identification |
Name: | Octanoic acid,4-methyl- |
Synonyms: | 4-Methylcaprylicacid;4-Methyloctanoic acid;Hircinoic acid;4-Methyl octanoic acid; |
CAS: | 54947-74-9 |
EINECS: | 259-404-2 |
Molecular Formula: | C9H18O2 |
Molecular Weight: | 158.24 |
InChI: | InChI=1/C9H18O2/c1-3-4-5-8(2)6-7-9(10)11/h8H,3-7H2,1-2H3,(H,10,11) |
Molecular Structure: |
 |
Properties |
Transport: | UN 3265 8/PG 3 |
Density: | 0.91 |
Refractive index: | 1.433 |
Appearance: | COA |
Specification: | Safety Statements:26-36/37/39-45 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face
protection 45:In case of accident or if you feel unwell, seek medical
advice immediately (show label where possible) |
Packinggroup: | III |
Storage Temperature: | −20°C |
Safety Data |
Hazard Symbols |
C:Corrosive
|
|
 |