| Identification | |
| Name: | sodium 4-chloro-3,5-dimethylphenolate |
| Synonyms: | sodium 4-chloro-3,5-dimethylphenolate;Sodium 3,5-dimethyl-4-chlorophenate;Sodium 3,5-dimethyl-4-chlorophenolate;Einecs 259-424-1;Phenol, 4-chloro-3,5-dimethyl-, sodium salt;Phenol, 4-chloro-3,5-dimethyl-, sodium salt (1:1) |
| CAS: | 54983-54-9 |
| EINECS: | 259-424-1 |
| Molecular Formula: | C8H8ClNaO |
| Molecular Weight: | 178.59129 |
| InChI: | InChI=1/C8H9ClO.Na/c1-5-3-7(10)4-6(2)8(5)9;/h3-4,10H,1-2H3;/q;+1/p-1 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 115.5 deg C |
| Flash Point: | 105.9°C |
| Boiling Point: | 246°C at 760 mmHg |
| Solubility: | At 15 deg C in petroleum ether, benzene, acetone, toluene, chloroform, isopropanol solubility of 0.5, 6.0, 58.0, 7.0, 6.2, 38.0 g/100mL, respectively. At 25 deg C in isopropanol, 1 M NaOH and glycerine solubility of 50.0, 8.8 and 1.5, respectively. Soluble in ethanol, ether. Slightly soluble in benzene and pet ether. Soluble 1 part of 95% alcohol, ether, benzene, terpenes fixed oils, solutions of alkali and hydroxides In water, 2.5X10+2 mg/L at 20 deg C |
| Flash Point: | 105.9°C |
| Color: | Crystals from benzene |
| Safety Data | |
 |
|
