| Identification | |
| Name: | Benzenamine,5-(4-morpholinyl)-2-nitro- |
| Synonyms: | 4-(3-Amino-4-nitrophenyl)morpholine;5-(4-Morpholinyl)-2-nitroaniline; 5-(Morpholin-4-yl)-2-nitrophenylamine;5-Morpholino-2-nitroaniline; AMA 30; N-(3-Amino-4-nitrophenyl)morpholine |
| CAS: | 54998-00-4 |
| Molecular Formula: | C10H13 N3 O3 |
| Molecular Weight: | 223.23 |
| InChI: | InChI=1/C10H13N3O3/c11-9-7-8(1-2-10(9)13(14)15)12-3-5-16-6-4-12/h1-2,7H,3-6,11H2 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 182-185°C |
| Flash Point: | 237.9°C |
| Boiling Point: | 469.7°C at 760 mmHg |
| Density: | 1.337g/cm3 |
| Refractive index: | 1.623 |
| Specification: | Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Flash Point: | 237.9°C |
| Safety Data | |
 |
|
