| Identification | |
| Name: | 1,2-Benzenediol,4-(2-amino-1-hydroxyethyl)-, hydrochloride (1:1) |
| CAS: | 55-27-6 |
| EINECS: | 200-229-8 |
| Molecular Formula: | C8H11 N O3 . Cl H |
| Molecular Weight: | 205.66 |
| InChI: | InChI=1/C8H11NO3/c9-4-8(12)5-1-2-6(10)7(11)3-5/h1-3,8,10-12H,4,9H2/p+1/t8-/m0/s1 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2811 |
| Melting Point: | 140-144 °C (dec.) |
| Flash Point: | 221.5°C |
| Boiling Point: | 442.6°Cat760mmHg |
| Density: | 1.397g/cm3 |
| Specification: |
(+-)-Norepinephrine hydrochloride (CAS NO.55-27-6) is also called (+-)-Noradrenaline HCl ; (+-)-Noradrenaline hydrochloride ; (3,4-Dihydroxyphenyl)-1-amino-2-ethanol-1, hydrochloride ; NSC 7930 ; dl-Arterenol hydrochloride ;1,2-Benzenediol, 4-(2-amino-1-hydroxyethyl)-, hydrochloride, (+-)- (9CI) ; Benzyl alcohol, alpha-(aminomethyl)-3,4-dihydroxy-, hydrochloride-, (+-)- ; DL-alpha-(Aminomethyl)-3,4-dihydroxybenzyl alcohol . (+-)-Norepinephrine hydrochloride (CAS NO.55-27-6) is off-white to tan crystalline. |
| Packinggroup: | III |
| Flash Point: | 221.5°C |
| Storage Temperature: | 2-8°C |
| Color: | off-white to tan |
| Safety Data | |
 |
|
