| Identification | |
| Name: | Benzenemethanamine,N,N-bis(2-chloroethyl)- |
| Synonyms: | Benzylamine,N,N-bis(2-chloroethyl)- (6CI,7CI,8CI);Benzylbis(2-chloroethyl)amine;Bis(2-chloroethyl)benzylamine;N,N-Bis(2-chloroethyl)benzylamine;N-Benzyl-N,N-bis(2-chloroethyl)amine;N-Benzylnormechlorethamine; |
| CAS: | 55-51-6 |
| Molecular Formula: | C11H15Cl2N |
| Molecular Weight: | 232.17 |
| InChI: | InChI=1/C11H15Cl2N/c12-6-8-14(9-7-13)10-11-4-2-1-3-5-11/h1-5H,6-10H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 100.5°C |
| Boiling Point: | 242.6°Cat760mmHg |
| Density: | 1.15g/cm3 |
| Refractive index: | 1.538 |
| Specification: |
N,N-Bis(2-chloroethyl)benzenemethanamine (55-51-6) also can be called Di-(2-chloroethyl)-benzylamine ; Benzyl nor-mechlorethamine ; Bis(2-chloroethyl)benzylamine ; N-Benzylnormechlorethamine ; Benzylbis(beta-chloroethyl)amine .It is combustible and its burning will bring toxic nitrogen oxidesa and chlorine fumes. |
| Report: |
EPA Genetic Toxicology Program. |
| Flash Point: | 100.5°C |
| Safety Data | |
 |
|
