| Identification | |
| Name: | N-Methylphthalimide |
| Synonyms: | 1H-Isoindole-1,3(2H)-dione, 2-methyl-;5-21-10-00273 (Beilstein Handbook Reference);1H-Isoindole-1, 3 (2H)-dione, 2-methyl-;Phthalimide, N-methyl-;2-Methyl-isoindole-1,3-dione; |
| CAS: | 550-44-7 |
| EINECS: | 208-982-4 |
| Molecular Formula: | C9H7NO2 |
| Molecular Weight: | 161.16 |
| InChI: | InChI=1/C9H7NO2/c1-10-8(11)6-4-2-3-5-7(6)9(10)12/h2-5H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.314 g/cm3 |
| Refractive index: | |
| Solubility: | Slightly soluble |
| Specification: | Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Report: |
Reported in EPA TSCA Inventory. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
