Identification |
Name: | Phenol,4-[(7-chloro-4-quinolinyl)amino]-2-(1-pyrrolidinylmethyl)- |
Synonyms: | o-Cresol,4-[(7-chloro-4-quinolyl)amino]-a-1-pyrrolidinyl- (6CI,7CI,8CI); 4-[(7-Chloro-4-quinolyl)amino]-a-1-pyrrolidinyl-o-cresol;Amopyroquin; Amopyroquine; PAM-780; Propoquin |
CAS: | 550-81-2 |
Molecular Formula: | C20H20 Cl N3 O |
Molecular Weight: | 0 |
InChI: | InChI=1/C20H20ClN3O/c21-15-3-5-17-18(7-8-22-19(17)12-15)23-16-4-6-20(25)14(11-16)13-24-9-1-2-10-24/h3-8,11-12,25H,1-2,9-10,13H2,(H,22,23) |
Molecular Structure: |
![(C20H20ClN3O) o-Cresol,4-[(7-chloro-4-quinolyl)amino]-a-1-pyrrolidinyl- (6CI,7CI,8CI); 4-[(7-Chloro-4-quinolyl)ami...](https://img1.guidechem.com/chem/e/dict/181/550-81-2.jpg) |
Properties |
Flash Point: | 255.1°C |
Boiling Point: | 498.1°Cat760mmHg |
Density: | 1.351g/cm3 |
Refractive index: | 1.718 |
Specification: | Pale Yellow Solid usageEng:Antimalarial agent. The compound showed antimalarial activity similar to that of Chloroquine. |
Flash Point: | 255.1°C |
Storage Temperature: | Refrigerator |
Usage: | Antimalarial agent. The compound showed antimalarial activity similar to that of Chloroquine. |
Safety Data |
|
 |