| Identification | |
| Name: | Prosta-5,13-dien-1-oicacid, 9,11,15-trihydroxy-, (5Z,9a,11a,13E,15S)- |
| Synonyms: | (+)-ProstaglandinF2a;7-[3,5-Dihydroxy-2-(3-hydroxy-1-octenyl)cyclopentyl]-5-heptenoic acid;9a,11a,15(S)-Trihydroxy-5-cis-13-trans-prostadienoic acid;9a,11a-PGF2;9a,11a-PGF2a;Amoglandin;Cyclosin;Cyclosin (pharmaceutical);Dinifertin;Dinoprost;Enzaprost;Enzaprost F;Glandin N;PGF2a;Panacelan;Prostaglandin F2;Prostaglandin F2a;Prostamate;Prostarmon F;Prostin F 2 alpha;Protamodin;U 14583; |
| CAS: | 551-11-1 |
| Molecular Formula: | C20H34O5 |
| Molecular Weight: | 354.48096 |
| InChI: | InChI=1S/C20H34O5/c1-2-3-6-9-15(21)12-13-17-16(18(22)14-19(17)23)10-7-4-5-8-11-20(24)25/h4,7,12-13,15-19,21-23H,2-3,5-6,8-11,14H2,1H3,(H,24,25)/b7-4-,13-12+/t15-,16+,17+,18-,19+/m0/s1 |
| Molecular Structure: | ![(C20H34O5) (+)-ProstaglandinF2a;7-[3,5-Dihydroxy-2-(3-hydroxy-1-octenyl)cyclopentyl]-5-heptenoic acid;9a,11a,15...](https://img.guidechem.com/casimg/551-11-1.gif) |
| Properties | |
| Density: | 1.153 g/cm3 |
| Stability: | Stable for 2 yr in light resistant containers @ 5-15 C degrades in 1 wk when exposed to sunlight or in 3 mo @ 40 C stable in light, air, and heat. |
| Refractive index: | 1.569 |
| Water Solubility: | 100mg/ml soluble in 100% ethanol, DMSO or dimethyl formamide; also soluble in aqueous buffers (10mg/ml in PBS, pH 7.2). |
| Solubility: | 100mg/ml soluble in 100% ethanol, DMSO or dimethyl formamide; also soluble in aqueous buffers (10mg/ml in PBS, pH 7.2). |
| Appearance: | White to off-white crystalline solid. |
| Specification: | usageEng:One of the most biologically studied of the primary prostaglandins. Closely related to Prostaglandin E2 (PGE2) in that both prostaglandins are biosynthesized from the same precursors and that PGF2 is the synthetic reduction product of PGE2. Phospholipase |
| Storage Temperature: | Store in a tightly closed container. |
| Color: | NATURAL FORM, CRYSTALS |
| Usage: | Medication (vet). |
| Safety Data | |
 |
|
