| Identification | |
| Name: | 2,4-Imidazolidinedione,5-methyl-, (5R)- |
| Synonyms: | 2,4-Imidazolidinedione,5-methyl-, (R)- (9CI); (R)-(+)-5-Methylhydantoin;5(R)-Methylimidazolidine-2,4-dione; D-5-Methylhydantoin |
| CAS: | 55147-68-7 |
| Molecular Formula: | C4H6 N2 O2 |
| Molecular Weight: | 114.1 |
| InChI: | InChI=1S/C4H6N2O2/c1-2-3(7)6-4(8)5-2/h2H,1H3,(H2,5,6,7,8)/t2-/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.216g/cm3 |
| Specification: |
The (R)-5-Methylhydantoin with cas registry number of 55147-68-7, is also called 2,4-Imidazolidinedione,5-methyl-, (R)- (9CI); 5(R)-Methylimidazolidine-2,4-dione. The (R)-5-Methylhydantoin belongs to the following product categories: (1)Hydantoins and Derivatives; (2)Hydantoins & Derivatives. Physical properties of (R)-5-Methylhydantoin: (1)ACD/LogP: -1.20; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): -1.2; (4)ACD/LogD (pH 7.4): -1.2; (5)ACD/BCF (pH 5.5): 1; (6)ACD/BCF (pH 7.4): 1; (7)ACD/KOC (pH 5.5): 5.31; (8)ACD/KOC (pH 7.4): 5.27; (9)#H bond acceptors: 4; (10)#H bond donors: 2; (11)#Freely Rotating Bonds: 0; (12)Polar Surface Area: 40.62 Å2; (13)Index of Refraction: 1.456; (14)Molar Refractivity: 25.5 cm3; (15)Molar Volume: 93.7 cm3; (16)Polarizability: 10.1×10-24cm3; (17)Surface Tension: 33.3 dyne/cm. Chemical properties of (R)-5-Methylhydantoin: white crystalline solid. You can still convert the following datas into molecular structure: (1)SMILES:O=C1NC(=O)NC1C; (2)InChI:InChI=1/C4H6N2O2/c1-2-3(7)6-4(8)5-2/h2H,1H3,(H2,5,6,7,8); (3)InChIKey:VMAQYKGITHDWKL-UHFFFAOYAI; (4)Std. InChI:InChI=1S/C4H6N2O2/c1-2-3(7)6-4(8)5-2/h2H,1H3,(H2,5,6,7,8); (5)Std. InChIKey:VMAQYKGITHDWKL-UHFFFAOYSA-N. |
| Safety Data | |
 |
|
