| Identification | |
| Name: | 1,2,4-Benzenetricarboxylic anhydride |
| Synonyms: | Trimellitic acid anhydride;1, 3-Dioxo-5-phthalancarboxylic acid;Epon 9150;1,3-Dihydro-1, 3-dioxo-5-isobenzofurancarboxylic acid;4-Carboxyphthalic anhydride;5-Isobenzofurancarboxylic acid,1,3-dihydro-1,3-dioxo-;Trimellitic acid, cyclic 1,2-anhydride;Anhydrotrimellic acid;Trimellic acid anhydride;Trimellic acid 1, 2-anhydride;5-Isobenzofurancarboxylic acid, 1,3-dihydro-1,3-dioxo-;1,3-dioxoisobenzofuran-5-carboxylic acid;1, 2,4-Benzenetricarboxylic acid 1,2-anhydride;Trimellitic acid 1, 2-anhydride;Trimellitic Anhydride(TMA);benzene-1,2,4-tricarboxylic acid 1,2-anhydride; |
| CAS: | 552-30-7 |
| EINECS: | 209-008-0 |
| Molecular Formula: | C9H4O5 |
| Molecular Weight: | 192.13 |
| InChI: | InChI=1/C9H4O5/c10-7(11)4-1-2-5-6(3-4)9(13)14-8(5)12/h1-3H,(H,10,11) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.54 |
| Stability: | Stable. Moisture sensitive. |
| Refractive index: | 1.662 |
| Water Solubility: | DECOMPOSES |
| Solubility: | DECOMPOSES |
| Appearance: | white to off-white flakes |
| HS Code: | 29173980 |
| Storage Temperature: | Store in a cool, dry place. Store in a tightly closed container. |
| Sensitive: | Moisture Sensitive |
| Color: | Crystals Colorless solid |
| Usage: | Trimellitic Anhydride is mainly used as raw material for polyester resin,polyimide resin,plasticizer TOTM ,and also be used for producing heatproof & insulating,adhesive,surfactant, paint,synthesize dye materials etc. Trimellitic anhydride is used as an embossing agent for vinyl flooring and as a curing agent for epoxy resins. It is also used as an intermediate for the synthesis of surface coatings chemicals, adhesives, polymers, dyes printing inks, pharmaceuticals . |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
