| Identification | |
| Name: | Paeonol |
| Synonyms: | Acetophenone,2'-hydroxy-4'-methoxy- (7CI,8CI);Peonol (6CI);1-(2-Hydroxy-4-methoxyphenyl)ethan-1-one;1-(4-Methoxy-2-hydroxyphenyl)ethanone;2-Acetyl-5-methoxyphenol;2-Hydroxy-4-methoxyphenyl methyl ketone;2'-Hydroxy-4'-methoxyacetophenone;4-O-Methylresacetophenone;4'-Methoxy-2'-hydroxyacetophenone;Resacetophenone 4-O-methyl ether; |
| CAS: | 552-41-0 |
| EINECS: | 209-012-2 |
| Molecular Formula: | C9H10O3 |
| Molecular Weight: | 166.18 |
| InChI: | InChI=1/C9H10O3/c1-6(10)8-4-3-7(12-2)5-9(8)11/h3-5,11H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.158g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.54322 (81.2 C) |
| Solubility: | Insoluble |
| Appearance: | white to beige crystalline powder |
| Specification: |
? Paeonol , with CAS number of 552-41-0, can be called 1-(2-Hydroxy-4-methoxyphenyl)ethan-1-one ; 1-(2-Hydroxy-4-methoxyphenyl)ethanone ; 1-(4-Methoxy-2-hydroxyphenyl)ethanone ; 2-Acetyl-5-methoxyphenol ; 2-Hydroxy-4-methoxyphenyl methyl ketone ; 2'-Hydroxy-4'-methoxyacetophenone ; 4-O-Methylresacetophenone ; Resacetophenone 4-O-methyl ether . It is a?white to beige crystalline powder,?Paeonol (CAS NO.552-41-0)can be used as analgesic. |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
