| Identification | |
| Name: | 1H-Purine-2,6-dione,3,7-dihydro-7-methyl- |
| Synonyms: | Heteroxanthine(6CI,7CI,8CI); 7-Methylxanthine; NSC 7861 |
| CAS: | 552-62-5 |
| EINECS: | 209-019-0 |
| Molecular Formula: | C6H6 N4 O2 |
| Molecular Weight: | 166.13 |
| InChI: | InChI=1/C6H6N4O2/c1-10-2-7-4-3(10)5(11)9-6(12)8-4/h2H,1H3,(H2,8,9,11,12) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | °C |
| Boiling Point: | °Cat760mmHg |
| Density: | 1.83g/cm3 |
| Refractive index: | 1.827 |
| Specification: |
7-Methylxanthine (CAS NO.552-62-5), its Synonyms are 1H-Purine-2,6-dione, 3,7-dihydro-7-methyl- ; 7-Methylxanthin ; Heteroxanthin ; Xanthine, 7-methyl- ; 1H-Purine-2,6-dione, 3,7-dihydro-7-methyl- (9CI) ; 3,7-Dihydro-7-methyl-1H-purine-2,6-dione ; Heteroxanthine (8CI) . |
| Flash Point: | °C |
| Usage: | Metabolite of Theophylline and Caffeine. |
| Safety Data | |
 |
|
