| Identification | |
| Name: | 9-Azabicyclo[3.3.1]nonan-3-one,9-methyl- |
| Synonyms: | Pseudopelletierine(6CI); 9-Methyl-3-granataninone; 9-Methyl-3-granatanone;9-Methyl-9-azabicyclo[3.3.1]nonan-3-one; Granatan-3-one; NSC 116056;Pseudopelletierin; Pseudopunicine; y-Pelletierine |
| CAS: | 552-70-5 |
| EINECS: | 209-021-1 |
| Molecular Formula: | C9H15 N O |
| Molecular Weight: | 153.22 |
| InChI: | InChI=1/C9H15NO/c1-10-7-3-2-4-8(10)6-9(11)5-7/h7-8H,2-6H2,1H3/t7-,8+ |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.033 g/cm3 |
| Refractive index: | 1.4760 (100<sup>o</sup>C) |
| Solubility: | Very soluble |
| Appearance: | colorless (yellows on exposure) |
| Specification: |
Pseudopelletierine , its cas register number is 552-70-5. It also can be called 3-Granataninone, 9-methyl- ; 9-Methyl-3-granatanone ; EINECS 209-021-1 ; Granatan-3-one ; Granatonine ; NSC 116056 ; Pseudopelletierin ; Pseudopelletrierin ; Pseudopunicine ; psi-Pelletierine ; 9-Azabicyclo(3.3.1)nonan-3-one, 9-methyl- ; 9-Methyl-9-azabicyclo(3.3.1)nonan-3-one .It is an alkaloid derived from the bark of the pomegranate tree.Also it is a homolog of tropinone. |
| Storage Temperature: | 2-8°C |
| Usage: | Material found in pomegranate bark possesses activity against intestinal tapeworm. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
