| Identification | |
| Name: | Phenol, 2-methoxy-,carbonate (2:1) |
| Synonyms: | Carbonicacid, bis(o-methoxyphenyl) ester (7CI,8CI);Guaiacol carbonate (6CI);Phenol,o-methoxy-, carbonate (8CI);Bis(2-methoxyphenyl) carbonate;Bis-o-methoxyphenyl carbonate;Carbonic acid bis(2-methoxyphenyl) ester;Carbonic acid guiacol ether;Di-o-methoxyphenyl carbonate;Diguaiacylcarbonate;Duotal;Guaiacol carbonic acid neutral ester;NSC 37138;NSC 3798;Tussophob; |
| CAS: | 553-17-3 |
| EINECS: | 209-034-2 |
| Molecular Formula: | C15H14O5 |
| Molecular Weight: | 274.27 |
| InChI: | InChI=1/C15H14O5/c1-17-11-7-3-5-9-13(11)19-15(16)20-14-10-6-4-8-12(14)18-2/h3-10H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.208 g/cm3 |
| Refractive index: | 1.552 |
| Specification: |
The Guaiacol carbonate with the CAS number 553-17-3 is also called Phenol, 2-methoxy-,carbonate (2:1). Both the systematic name and IUPAC name are bis(2-methoxyphenyl) carbonate. Its EINECS registry number is 209-034-2. The molecular formula is C15H14O5. The properties of the chemical are: (1)ACD/LogP: 2.41; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 2.41; (4)ACD/LogD (pH 7.4): 2.41; (5)ACD/BCF (pH 5.5): 39.87; (6)ACD/BCF (pH 7.4): 39.87; (7)ACD/KOC (pH 5.5): 486.8; (8)ACD/KOC (pH 7.4): 486.8; (9)#H bond acceptors: 5; (10)#H bond donors: 0; (11)#Freely Rotating Bonds: 6; (12)Polar Surface Area: 53.99 Å2; (13)Index of Refraction: 1.552; (14)Molar Refractivity: 72.56 cm3; (15)Molar Volume: 226.9 cm3; (16)Polarizability: 28.76×10-24cm3; (17)Surface Tension: 41 dyne/cm; (18)Enthalpy of Vaporization: 64.23 kJ/mol; (19)Vapour Pressure: 2.27×10-6 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
