| Identification | |
| Name: | 2-Propen-1-one,3-(dimethylamino)-1-(3-pyridinyl)- |
| Synonyms: | 3-(Dimethylamino)-1-(3-pyridinyl)-2-propen-1-one;3-Dimethylamino-1-(3-pyridyl)-2-propen-1-one;3-Dimethylamino-1-(pyridin-3-yl)propenone; |
| CAS: | 55314-16-4 |
| Molecular Formula: | C10H12N2O |
| Molecular Weight: | 176.21 |
| InChI: | InChI=1/C10H12N2O/c1-12(2)8-5-10(13)9-3-6-11-7-4-9/h3-8H,1-2H3/b8-5+ |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 86-88 ºC |
| Flash Point: | 124 ºC |
| Boiling Point: | 281.4 ºC at 760 mmHg |
| Density: | 1.07 g/cm3 |
| Refractive index: | 1.545 |
| Appearance: | Off-White Solid |
| Specification: |
1-(3-Pyridyl)-3-(dimethylamino)-2-propen-1-one (CAS NO.55314-16-4) is also called as 3-(Dimethylamino)-1-(3-pyridinyl)-2-propen-1-one ; 3-(Dimethylamino)-1-pyridin-3-ylprop-2-en-1-one ; 1-(3-Pyridyl)-3-(dimethylamino)-2-propen-1-one 95% ; 2-Propen-1-one,3-(dimethylamino)-1-(3-pyridinyl) ; 3-Dimethylamino-1-(pyridin-3-yl)propenone ; 1-(3-Pyridyl)-3-(dimethylamino)-2-propen-1-one ,97% . |
| Flash Point: | 124 ºC |
| Storage Temperature: | -20?C Freezer |
| Usage: |
1-(3-Pyridyl)-3-(dimethylamino)-2-propen-1-one (CAS NO.55314-16-4) can be used as intermediate of Imatinib . |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
