| Identification |
| Name: | Methyl propionate |
| Synonyms: | Propanoic acid methyl ester; Propionic acid methyl ester |
| CAS: | 554-12-1 |
| EINECS: | 209-060-4 |
| Molecular Formula: | C4H8O2 |
| Molecular Weight: | 88.11 |
| InChI: | InChI=1/C4H8O2/c1-3-4(5)6-2/h3H2,1-2H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 1248 |
| Density: | 0.915 |
| Stability: | Stable. Highly flammable. Incompatible with strong oxidizing agents, acids, bases. Readily forms explosive mixtures with air. Moisture sensitive. |
| Refractive index: | 1.377 |
| Solubility: | 5 g/100 mL at 20 oC |
| Appearance: | colourless liquid |
| Packinggroup: | II |
| Storage Temperature: | Flammables area |
| Color: | Colorless liq |
| Safety Data |
| Hazard Symbols |
F:Flammable
Xn:Harmful
|
| |
 |
