| Identification | |
| Name: | Triethylphosphine |
| Synonyms: | triethyl phosphine vial with 10 G; Triethylphosphine solution; Triethylphosphineredistilled; TriethylphosphineSureSealbottlecolorlessliq; Triethylphosphineinethanol; Triethylphosphin |
| CAS: | 554-70-1 |
| EINECS: | 209-068-8 |
| Molecular Formula: | C6H15P |
| Molecular Weight: | 118.157061 |
| InChI: | InChI=1S/C6H15P/c1-4-7(5-2)6-3/h4-6H2,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2845 |
| Melting Point: | -88 - -85 |
| Flash Point: | 1? |
| Density: | 0.802 |
| Refractive index: | 1.456 |
| Water Solubility: | SOLVENT |
| Solubility: | SOLVENT |
| Appearance: | clear liquid |
| Specification: | usageEng:suzuki reaction Safety Statements:26-36/37/39-45-7/9-33-16 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 7/9:Keep container tightly closed and in a well-ventilated place 33:Take precautionary measures against static discharges 16:Keep away from sources of ignition - No smoking |
| Packinggroup: | I |
| Flash Point: | 1? |
| Storage Temperature: | Flammables-area. |
| Sensitive: | Air & Moisture Sensitive |
| Usage: | Substance is used in organic syntheses. |
| Safety Data | |
| Hazard Symbols |
F:Flammable
C:Corrosive
|
 |
|
