| Identification | |
| Name: | 3-Nitrophenol |
| Synonyms: | 3-Hydroxy-1-nitrobenzene |
| CAS: | 554-84-7 |
| EINECS: | 209-073-5 |
| Molecular Formula: | C6H5NO3 |
| Molecular Weight: | 139.11 |
| InChI: | InChI=1/C6H5NO3/c8-6-3-1-2-5(4-6)7(9)10/h1-4,8H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1663 |
| Density: | 1.49 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.612 |
| Solubility: | 13.5 g/L (25 oC) in water |
| Appearance: | yellow crystals |
| Specification: |
3-Nitrophenol , with CAS number of 554-84-7, can be called Phenol,m-nitro- (8CI) ; 1-Hydroxy-3-nitrobenzene ; 3-Hydroxynitrobenzene ; m-Hydroxynitrobenzene ; m-Nitrophenol . It is a yellow to brown crystalline powder, 3-Nitrophenol (CAS NO.554-84-7) is used as a medicine, dyes intermediates. |
| Report: |
EPA Genetic Toxicology Program. Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| HS Code: | 29089000 |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Keep from contact with oxidizing materials. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Color: | Monoclinic prisms from ether & dilute hydrochloric acid COLORLESS TO YELLOW MONOCLINIC FORM |
| Usage: | As indicator in 0.3% Soln in 50% alcohol ph: 6.8 Colorless, 8.6 Yellow. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
