| Identification | |
| Name: | 1,3,5-Benzenetricarboxylic acid |
| Synonyms: | Trimesic acid; 1,3,5-Trimesic Acid |
| CAS: | 554-95-0 |
| EINECS: | 209-077-7 |
| Molecular Formula: | C9H6O6 |
| Molecular Weight: | 210.14 |
| InChI: | InChI=1/C9H6O6/c10-7(11)4-1-5(8(12)13)3-6(2-4)9(14)15/h1-3H,(H,10,11)(H,12,13)(H,14,15) |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Flash Point: | 328 C |
| Density: | 1.654g/cm3 |
| Stability: | Stable, but may be light sensitive. |
| Solubility: | Very soluble |
| Appearance: | White crystalline powder |
| HS Code: | 29173980 |
| Flash Point: | 328 C |
| Storage Temperature: | Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Usage: | is mainly used in the industry of poxy curing agent ,Adhesives and coating material ,Engineering plastic ,Synthetic fiber ,Cross-linking agent for alkyd resin ,Plasticizer ,Pharmaceutical intermediates, Desalination membrane etc. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
