Identification |
Name: | 1H-Purine-2,6,8(3H)-trione,7,9-dihydro-9-methyl- |
Synonyms: | 9-Methyl-3,7-dihydropurine-2,6,8-trione;9-Methyluric acid; |
CAS: | 55441-71-9 |
EINECS: | 259-641-1 |
Molecular Formula: | C6H6N4O3 |
Molecular Weight: | 182.13684 |
InChI: | InChI=1S/C6H6N4O3/c1-10-3-2(7-6(10)13)4(11)9-5(12)8-3/h1H3,(H,7,13)(H2,8,9,11,12) |
Molecular Structure: |
|
Properties |
Density: | 1.73 g/cm3 |
Refractive index: | 1.695 |
Water Solubility: | 0.021 mg/mL at 25 oC [BEILSTEIN] |
Solubility: | 0.021 mg/mL at 25 oC [BEILSTEIN] |
Appearance: | white to light yellow powder |
Color: | white to light yellow |
Safety Data |
|
|