| Identification | |
| Name: | 1,1-dimethylhydrazine dihydrochloride |
| Synonyms: | 1,1-dimethylhydrazine dihydrochloride |
| CAS: | 55484-54-3 |
| EINECS: | 259-664-7 |
| Molecular Formula: | C2H10Cl2N2 |
| Molecular Weight: | 133.0202 |
| InChI: | InChI=1S/C2H8N2/c1-4(2)3/h3H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | -58 deg C |
| Boiling Point: | 63.9 deg C at 760 mm Hg |
| Solubility: | Very sol in methanol and ethanol >10% in water Miscible with dimethylformamide, hydrocarbons, alcohol, ether Miscible in water at 25 deg C |
| Color: | CLEAR, COLORLESS LIQUID Colorless liquid |
| Safety Data | |
 |
|
