Identification |
Name: | Nifuroxime |
Synonyms: | Nifuroxime~5-Nitrofurfural oxime; anti-5-Nitro-2-furaldoxime; 5-Nitro-2-furaldoxime, (Nifuroxime; 5-Nitrofurfural oxime); 5-Nitro-2-furaldehyde oxime; 5-Nitro-2-furaldoxime |
CAS: | 555-15-7 |
EINECS: | 209-082-4 |
Molecular Formula: | C5H4N2O4 |
Molecular Weight: | 156.09 |
InChI: | InChI=1/C5H4N2O4/c8-6-3-4-1-2-5(11-4)7(9)10/h1-3,8H/b6-3+ |
Molecular Structure: |
 |
Properties |
Transport: | 2811 |
Flash Point: | 120°C |
Boiling Point: | 274.8°Cat760mmHg |
Density: | 1.58g/cm3 |
Specification: | YELLOW TO BROWN-YELLOW POWDER Safety Statements:22-36/37 22:Do not breathe dust 36/37:Wear suitable protective clothing and gloves |
Packinggroup: | III |
Flash Point: | 120°C |
Sensitive: | Light Sensitive |
Safety Data |
|
 |