| Identification | |
| Name: | Bis(p-chlorophenoxy)methane |
| Synonyms: | Methane,bis(p-chlorophenoxy)- (6CI,7CI,8CI);Bis(4-chlorophenoxy)methane;DCPM;K 1875;NSC 6172;Neotran;Oxythane |
| CAS: | 555-89-5 |
| EINECS: | 209-107-9 |
| Molecular Formula: | C13H10 Cl2 O2 |
| Molecular Weight: | 269.13 |
| InChI: | InChI=1/C13H10Cl2O2/c14-10-1-5-12(6-2-10)16-9-17-13-7-3-11(15)4-8-13/h1-8H,9H2 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.308 g/cm3 |
| Refractive index: | 1.585 |
| Specification: |
Bis-(4-chlorophenoxy)methane with CAS number of 555-89-5 is also called for 1,1'-(Methylenebis(oxy))bis(4-chloro)benzene ; 4-06-00-00833 (Beilstein Handbook Reference) ; AI3-15208 ; BRN 1978248 ; Bis(4-chlorophenoxy)methane ; Bis(p-chlorophenoxy)methane ; Caswell No. 091 ; DCPM ; Di-(4-chlorophenoxy)methane ; Di-(p-chlorophenoxy)methane ; Di-p-chlorodiphenoxymethane ; EINECS 209-107-9 ; ENT 15,208 ; K 1875 ; NSC 6172 ; Neotran ; Oxythane . |
| Safety Data | |
 |
|
