| Identification | |
| Name: | Propanoic acid,2-([1,1'-biphenyl]-4-yloxy)- |
| Synonyms: | Propionicacid, 2-(4-biphenylyloxy)- (7CI,8CI); NSC 522948; a-(4-Phenylphenoxy)propionic acid |
| CAS: | 5555-13-5 |
| Molecular Formula: | C15H14 O3 |
| Molecular Weight: | 242.29 |
| InChI: | InChI=1/C15H14O3/c1-11(15(16)17)18-14-9-7-13(8-10-14)12-5-3-2-4-6-12/h2-11H,1H3,(H,16,17) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 155.7°C |
| Boiling Point: | 412.4°Cat760mmHg |
| Density: | 1.171g/cm3 |
| Refractive index: | 1.574 |
| Specification: |
alpha-(4-Biphenylyloxy)propionic acid , its cas register number is 5555-13-5. It also can be called Propionic acid, 2-(4-biphenylyloxy)- ; Propanoic acid, 2-([1,1'-biphenyl]-4-yloxy)- ; and 2-(Biphenyl-4-yloxy)propanoic acid . |
| Flash Point: | 155.7°C |
| Safety Data | |
| Hazard Symbols | |
 |
|
