| Identification | |
| Name: | 1H-1,4-Diazepine,hexahydro-1,4-dinitroso- |
| Synonyms: | Dinitrosohomopiperazine |
| CAS: | 55557-00-1 |
| Molecular Formula: | C5H10 N4 O2 |
| Molecular Weight: | 158.19 |
| InChI: | InChI=1/C5H10N4O2/c10-6-8-2-1-3-9(7-11)5-4-8/h1-5H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 197.6°C |
| Boiling Point: | 403.1°C at 760 mmHg |
| Density: | 1.43g/cm3 |
| Refractive index: | 1.622 |
| Specification: |
N,N-Dinitrosohomopiperazine , its cas register number is 55557-00-1. It also can be called BRN 0147155 ; 1H-1,4-Diazepine, hexahydro-1,4-dinitroso- ; and Dinitrosohomopiperazine . |
| Report: |
EPA Genetic Toxicology Program. |
| Flash Point: | 197.6°C |
| Safety Data | |
 |
|
