| Identification | |
| Name: | 25951-70-6 |
| Synonyms: | ethylene; n-(hydroxymethyl)prop-2-enamide; vinyl acetate;AC1L51VX;AC1Q5X9Q;AR-1J0642;Acetic acid ethenyl ester, polymer with ethene and N-(hydroxymethyl)-2-propenamide;ethene; ethenyl acetate; N-(hydroxymethyl)prop-2-enamide;Vinyl acetate, ethylene, N-methylol acrylamide terpolymer;25951-70-6 |
| CAS: | 55599-81-0 |
| Molecular Formula: | C10H17NO4 |
| Molecular Weight: | 215.24628 |
| InChI: | InChI=1S/C4H7NO2.C4H6O2.C2H4/c1-2-4(7)5-3-6;1-3-6-4(2)5;1-2/h2,6H,1,3H2,(H,5,7);3H,1H2,2H3;1-2H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 146.2°C |
| Boiling Point: | 318.1°Cat760mmHg |
| Density: | g/cm3 |
| Flash Point: | 146.2°C |
| Safety Data | |
 |
|
