| Identification | |
| Name: | L-Cysteine,S-2-propen-1-yl-, S-oxide, [S(S)]- |
| Synonyms: | Alanine,3-(allylsulfinyl)- (7CI);Alanine, 3-(allylsulfinyl)-, (S)-L- (8CI);L-Alanine,3-(2-propenylsulfinyl)-, (S)-;L-Alanine, 3-[(S)-2-propenylsulfinyl]- (9CI);(+)-L-Alliin;Alliin;S-Allyl-L-cysteine-(+)-sulfoxide; |
| CAS: | 556-27-4 |
| EINECS: | 209-118-9 |
| Molecular Formula: | C6H11NO3S |
| Molecular Weight: | 177.2214 |
| InChI: | InChI=1/C6H11NO3S/c1-2-3-11(10)4-5(7)6(8)9/h2,5H,1,3-4,7H2,(H,8,9)/t5-,11?/m0/s1 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 165 |
| Density: | 1.354 g/cm3 |
| Stability: | Stable at normal temperatures and pressures. |
| Refractive index: | 1.579 |
| Solubility: | 25 g/L (25 C) |
| Appearance: | White to off white crystalline powder |
| Specification: |
?(S)-3-(Allylsulphinyl)-L-alanine , its cas register number is 556-27-4. It also can be called Alliin ; (2R)-2-Amino-3-[(S)-prop-2-enylsulfinyl]propanoic acid ; and (2R)-3-(Allylsulfinyl)-2-aminopropanoic acid . |
| Usage: | Component of garlic. |
| Safety Data | |
 |
|
