| Identification | |
| Name: | 1,4-Cyclohexanediol |
| Synonyms: | 1,4-Dihydroxycyclohexane;NSC 5651;Quinitol;1,4-Cyclohexanediol(Mixture of Cis and Trans);cyclohexane-1,4-diol; |
| CAS: | 556-48-9 |
| EINECS: | 209-126-2 |
| Molecular Formula: | C6H12O2 |
| Molecular Weight: | 110.11064 |
| InChI: | InChI=1S/C6H6O2/c7-5-1-2-6(8)4-3-5/h1-4,7-8H |
| Molecular Structure: |  |
| Properties | |
| Transport: | 1325 |
| Melting Point: | 98-100 oC |
| Flash Point: | 150 oF |
| Density: | 1.156 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.526 |
| Water Solubility: | Soluble in water |
| Solubility: | Soluble in water |
| Appearance: | White Powder |
| Specification: | white to off-white crystalline powder Safety Statements:24/25 24/25:Avoid contact with skin and eyes |
| Packinggroup: | III |
| HS Code: | 29061900 |
| Flash Point: | 150 oF |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Color: | White crystals Monoclinic prisms (sublimation); needles from water; prisms from methanol Light-tan, light-gray, or colorless crystals. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
