| Identification | |
| Name: | Benzene,1-bromo-3,5-dimethyl- |
| Synonyms: | m-Xylene,5-bromo- (6CI,7CI,8CI);1-Bromo-3,5-dimethylbenzene;1-Bromo-3,5-xylene;3,5-Dimethyl-1-bromobenzene;3,5-Dimethylbromobenzene;3,5-Dimethylphenylbromide;5-Bromo-1,3-xylene; |
| CAS: | 556-96-7 |
| Molecular Formula: | C8H9Br |
| Molecular Weight: | 185.06 |
| InChI: | InChI=1/C8H9Br/c1-6-3-7(2)5-8(9)4-6/h3-5H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.362 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.5475-1.5495 |
| Appearance: | pale yellow to clear transparent liquid |
| Specification: |
?3,5-Dimethylbromobenzene (CAS NO.556-96-7)? is also called 5-Bromo-1,3-xylene ; m-Xylene, 5-bromo- ;?5-Bromo-m-xylene ; 5-Bromometaxylene ; 5-Bromo-3,5-dimethylbenzene ; 1-Bromo-3,5-dimethylbenzene . |
| HS Code: | 29036990 |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
