Identification |
Name: | 2-Mercapto-5-methoxybenzothiazole |
Synonyms: | 5-Methoxybenzothiazole-2-thiol |
CAS: | 55690-60-3 |
EINECS: | 259-755-1 |
Molecular Formula: | C8H7NOS2 |
Molecular Weight: | 197.26 |
InChI: | InChI=1/C8H7NOS2/c1-10-5-2-3-7-6(4-5)9-8(11)12-7/h2-4H,1H3,(H,9,11) |
Molecular Structure: |
![(C8H7NOS2) 5-Methoxybenzothiazole-2-thiol](https://img.guidechem.com/casimg/55690-60-3.gif) |
Properties |
Melting Point: | 190-193°C |
Flash Point: | 159.9°C |
Boiling Point: | 340.8°C at 760 mmHg |
Density: | 1.44g/cm3 |
Refractive index: | 1.728 |
Specification: | Safety Statements:22-24/25 22:Do not breathe dust 24/25:Avoid contact with skin and eyes |
Flash Point: | 159.9°C |
Safety Data |
|
![](/images/detail_15.png) |