| Identification | |
| Name: | 2-Pyridinamine,N-4-piperidinyl- |
| Synonyms: | (Piperidin-4-yl)(pyridin-2-yl)amine;2-(4-Piperidinylamino)pyridine; |
| CAS: | 55692-31-4 |
| Molecular Formula: | C10H15 N3 |
| Molecular Weight: | 177.25 |
| InChI: | InChI=1/C10H15N3/c1-2-6-12-10(3-1)13-9-4-7-11-8-5-9/h1-3,6,9,11H,4-5,7-8H2,(H,12,13) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 328 °C at 760 mmHg |
| Boiling Point: | 328 °C at 760 mmHg |
| Density: | 1.103g/cm3 |
| Refractive index: | 1.583 |
| Specification: |
The Piperidin-4-yl-pyridin-2-yl-amine , with the CAS register number 55692-31-4, is also known as the 2-(4-Piperidinylamino)pyridine . Properties of Piperidin-4-yl-pyridin-2-yl-amine are as follows: (1)#H bond acceptors: 3 ; (2)#H bond donors: 2 ; (3)#Freely Rotating Bonds: 1 ; (4)Polar Surface Area: 36.95 ; (5)Index of Refraction: 1.583 ; (6)Molar Refractivity: 53.72 cm3 ; (7)Molar Volume: 160.6 cm3 ; (8)Polarizability: 21.29 ×10-24cm3 ; (9)Surface Tension: 46.9 dyne/cm ; (10)Density: 1.103 g/cm3 ; (11)Flash Point: 152.2 °C ; (12)Enthalpy of Vaporization: 57.04 kJ/mol ; (13)Boiling Point: 328 °C at 760 mmHg ; (14)Vapour Pressure: 0.000194 mmHg at 25°C . And you could obatain the molecular structure by converting the following data information: |
| Flash Point: | 328 °C at 760 mmHg |
| Safety Data | |
 |
|
