| Identification |
| Name: | Octane, 2-bromo- |
| Synonyms: | sec-Octyl bromide;1-Methylheptylbromide;2-Bromooctane;2-Octyl bromide;NSC 8060; |
| CAS: | 557-35-7 |
| EINECS: | 209-171-8 |
| Molecular Formula: | C8H17Br |
| Molecular Weight: | 193.12458 |
| InChI: | InChI=1S/C8H17Br/c1-3-4-5-6-7-8(2)9/h8H,3-7H2,1-2H3 |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.093 |
| Stability: | Stable, but may be light sensitive. Incompatible with strong oxidizing agents. Combustible. |
| Refractive index: | 1.449 |
| Water Solubility: | negligible in water |
| Solubility: | negligible in water |
| Appearance: | colourless Volatile Liquid |
| Safety Data |
| |
 |
